C29H24ClF3N6O2 — CID 89365428
2-[1-[5-[(3Z,5E)-6-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-6-(3-chloro-4-pyridinyl)pyrazin-2-yl]piperidin-4-yl]isoindole-1,3-dione (PubChem CID 89365428) has the molecular formula C29H24ClF3N6O2 and a molecular weight of 581.00 g/mol. Its IUPAC name is 2-[1-[5-[(3Z,5E)-6-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-6-(3-chloro-4-pyridinyl)pyrazin-2-yl]piperidin-4-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[5-[(3Z,5E)-6-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-6-(3-chloro-4-pyridinyl)pyrazin-2-yl]piperidin-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 89365428 |
| Molecular Formula | C29H24ClF3N6O2 |
| Molecular Weight | 581.00 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 2-[1-[5-[(3Z,5E)-6-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-6-(3-chloro-4-pyridinyl)pyrazin-2-yl]piperidin-4-yl]isoindole-1,3-dione |
| SMILES | C=C(/C=C\C(=C/N)C(F)(F)F)c1ncc(N2CCC(N3C(=O)c4ccccc4C3=O)CC2)nc1-c1ccncc1Cl |
| InChI | InChI=1S/C29H24ClF3N6O2/c1-17(6-7-18(14-34)29(31,32)33)25-26(22-8-11-35-15-23(22)30)37-24(16-36-25)38-12-9-19(10-13-38)39-27(40)20-4-2-3-5-21(20)28(39)41/h2-8,11,14-16,19H,1,9-10,12-13,34H2/b7-6-,18-14+ |
| InChIKey | RIYPCEPULNFMIJ-QZOFVCSTSA-N |
| XLogP | 5.43 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.00 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|