C11H17NO — CID 89366304
N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propanamide (PubChem CID 89366304) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propanamide.
| Compound Name | N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propanamide |
|---|---|
| PubChem CID | 89366304 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propanamide |
| SMILES | C=C(C)/C=C\C(=C/C)NC(=O)CC |
| InChI | InChI=1S/C11H17NO/c1-5-10(8-7-9(3)4)12-11(13)6-2/h5,7-8H,3,6H2,1-2,4H3,(H,12,13)/b8-7-,10-5+ |
| InChIKey | GIIJLGOGCMEVGO-GBLFQTLVSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|