About 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine
1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine (PubChem CID 89366585) has the molecular formula C11H10ClF2N
and a molecular weight of 229.66 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine.
Molecular Properties
| Compound Name | 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine |
| PubChem CID | 89366585 |
| Molecular Formula | C11H10ClF2N |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine |
| SMILES | C=C(c1ccc(Cl)cc1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C11H10ClF2N/c1-8(15-6-11(13,14)7-15)9-2-4-10(12)5-3-9/h2-5H,1,6-7H2 |
| InChIKey | ORDZMNCUCKSPMO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine?
The IUPAC name of 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine (CID 89366585) is 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine.
What is the SMILES notation for 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine?
The canonical SMILES for 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine is C=C(c1ccc(Cl)cc1)N1CC(F)(F)C1.
What is the InChIKey of 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine?
The InChIKey is ORDZMNCUCKSPMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClF2N/c1-8(15-6-11(13,14)7-15)9-2-4-10(12)5-3-9/h2-5H,1,6-7H2.
What are the key properties of 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine?
1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine has a molecular weight of 229.66 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4-chlorophenyl)ethenyl]-3,3-difluoroazetidine is sourced from PubChem (CID 89366585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).