C23H22N2O7 — CID 89366685
(3Z,4E)-5-[2-[[2-(3,4-dihydroxy-5-nitrophenyl)acetyl]amino]phenyl]-3-ethylidenehepta-4,6-dienoic acid (PubChem CID 89366685) has the molecular formula C23H22N2O7 and a molecular weight of 438.44 g/mol. Its IUPAC name is (3Z,4E)-5-[2-[[2-(3,4-dihydroxy-5-nitrophenyl)acetyl]amino]phenyl]-3-ethylidenehepta-4,6-dienoic acid.
| Compound Name | (3Z,4E)-5-[2-[[2-(3,4-dihydroxy-5-nitrophenyl)acetyl]amino]phenyl]-3-ethylidenehepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 89366685 |
| Molecular Formula | C23H22N2O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (3Z,4E)-5-[2-[[2-(3,4-dihydroxy-5-nitrophenyl)acetyl]amino]phenyl]-3-ethylidenehepta-4,6-dienoic acid |
| SMILES | C=C/C(=C\C(=C/C)CC(=O)O)c1ccccc1NC(=O)Cc1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22N2O7/c1-3-14(13-22(28)29)9-16(4-2)17-7-5-6-8-18(17)24-21(27)12-15-10-19(25(31)32)23(30)20(26)11-15/h3-11,26,30H,2,12-13H2,1H3,(H,24,27)(H,28,29)/b14-3+,16-9+ |
| InChIKey | NHUPJLDTJYSRCI-ZFDMWBGCSA-N |
| XLogP | 4.18 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|