About 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one
7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one (PubChem CID 89366693) has the molecular formula C28H21N3O
and a molecular weight of 415.50 g/mol. Its IUPAC name is 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one.
Molecular Properties
| Compound Name | 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one |
| PubChem CID | 89366693 |
| Molecular Formula | C28H21N3O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one |
| SMILES | O=c1ccc(Cc2ccccc2)nc2[nH]c(-c3ccnc(/C=C/c4ccccc4)c3)cc12 |
| InChI | InChI=1S/C28H21N3O/c32-27-14-13-24(17-21-9-5-2-6-10-21)30-28-25(27)19-26(31-28)22-15-16-29-23(18-22)12-11-20-7-3-1-4-8-20/h1-16,18-19,31H,17H2/b12-11+ |
| InChIKey | WVSYHBCHNAJQQC-VAWYXSNFSA-N |
| XLogP | 5.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one?
The IUPAC name of 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one (CID 89366693) is 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one.
What is the SMILES notation for 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one?
The canonical SMILES for 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one is O=c1ccc(Cc2ccccc2)nc2[nH]c(-c3ccnc(/C=C/c4ccccc4)c3)cc12.
What is the InChIKey of 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one?
The InChIKey is WVSYHBCHNAJQQC-VAWYXSNFSA-N. The full InChI is InChI=1S/C28H21N3O/c32-27-14-13-24(17-21-9-5-2-6-10-21)30-28-25(27)19-26(31-28)22-15-16-29-23(18-22)12-11-20-7-3-1-4-8-20/h1-16,18-19,31H,17H2/b12-11+.
What are the key properties of 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one?
7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one has a molecular weight of 415.50 g/mol, XLogP of 5.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-2-[2-[(E)-2-phenylethenyl]-4-pyridinyl]-1H-pyrrolo[2,3-b]azepin-4-one is sourced from PubChem (CID 89366693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).