C14H13F3N6O — CID 89366801
2-amino-4-[[4-(2,2,2-trifluoroethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenol (PubChem CID 89366801) has the molecular formula C14H13F3N6O and a molecular weight of 338.29 g/mol. Its IUPAC name is 2-amino-4-[[4-(2,2,2-trifluoroethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenol.
| Compound Name | 2-amino-4-[[4-(2,2,2-trifluoroethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 89366801 |
| Molecular Formula | C14H13F3N6O |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-amino-4-[[4-(2,2,2-trifluoroethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenol |
| SMILES | Nc1cc(Nc2nc(NCC(F)(F)F)c3cc[nH]c3n2)ccc1O |
| InChI | InChI=1S/C14H13F3N6O/c15-14(16,17)6-20-12-8-3-4-19-11(8)22-13(23-12)21-7-1-2-10(24)9(18)5-7/h1-5,24H,6,18H2,(H3,19,20,21,22,23) |
| InChIKey | FHOPAUFUAUZURU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|