About (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene
(6Z)-8-methoxy-2,6-dimethylnona-2,6-diene (PubChem CID 89366865) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene.
Molecular Properties
| Compound Name | (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene |
| PubChem CID | 89366865 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene |
| SMILES | COC(C)/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C12H22O/c1-10(2)7-6-8-11(3)9-12(4)13-5/h7,9,12H,6,8H2,1-5H3/b11-9- |
| InChIKey | VMXVRNJXIDFSKF-LUAWRHEFSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene?
The IUPAC name of (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene (CID 89366865) is (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene.
What is the SMILES notation for (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene?
The canonical SMILES for (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene is COC(C)/C=C(/C)CCC=C(C)C.
What is the InChIKey of (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene?
The InChIKey is VMXVRNJXIDFSKF-LUAWRHEFSA-N. The full InChI is InChI=1S/C12H22O/c1-10(2)7-6-8-11(3)9-12(4)13-5/h7,9,12H,6,8H2,1-5H3/b11-9-.
What are the key properties of (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene?
(6Z)-8-methoxy-2,6-dimethylnona-2,6-diene has a molecular weight of 182.31 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-8-methoxy-2,6-dimethylnona-2,6-diene is sourced from PubChem (CID 89366865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).