C36H70O5Si — CID 89367112
(4R,5S,6E,9E,12R,15S)-4,12,16-tributoxy-1-[tert-butyl(dimethyl)silyl]oxy-5,15-dimethylhexadeca-6,9-dien-8-one (PubChem CID 89367112) has the molecular formula C36H70O5Si and a molecular weight of 611.04 g/mol. Its IUPAC name is (4R,5S,6E,9E,12R,15S)-4,12,16-tributoxy-1-[tert-butyl(dimethyl)silyl]oxy-5,15-dimethylhexadeca-6,9-dien-8-one.
| Compound Name | (4R,5S,6E,9E,12R,15S)-4,12,16-tributoxy-1-[tert-butyl(dimethyl)silyl]oxy-5,15-dimethylhexadeca-6,9-dien-8-one |
|---|---|
| PubChem CID | 89367112 |
| Molecular Formula | C36H70O5Si |
| Molecular Weight | 611.04 g/mol |
| Exact Mass | 610.50 |
| IUPAC Name | (4R,5S,6E,9E,12R,15S)-4,12,16-tributoxy-1-[tert-butyl(dimethyl)silyl]oxy-5,15-dimethylhexadeca-6,9-dien-8-one |
| SMILES | CCCCOC[C@@H](C)CC[C@H](C/C=C/C(=O)/C=C/[C@H](C)[C@@H](CCCO[Si](C)(C)C(C)(C)C)OCCCC)OCCCC |
| InChI | InChI=1S/C36H70O5Si/c1-11-14-26-38-30-31(4)22-25-34(39-27-15-12-2)20-17-19-33(37)24-23-32(5)35(40-28-16-13-3)21-18-29-41-42(9,10)36(6,7)8/h17,19,23-24,31-32,34-35H,11-16,18,20-22,25-30H2,1-10H3/b19-17+,24-23+/t31-,32-,34-,35+/m0/s1 |
| InChIKey | MENTTZPTZVAZCC-ILXYHXKASA-N |
| XLogP | 10.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.04 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|