About (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole
(3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole (PubChem CID 89367458) has the molecular formula C8H9NS
and a molecular weight of 151.23 g/mol. Its IUPAC name is (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole |
| PubChem CID | 89367458 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole |
| SMILES | CC1=N[C@@H]2CC=CC=C2S1 |
| InChI | InChI=1S/C8H9NS/c1-6-9-7-4-2-3-5-8(7)10-6/h2-3,5,7H,4H2,1H3/t7-/m1/s1 |
| InChIKey | XUXQTAHHOYGSAM-SSDOTTSWSA-N |
| XLogP | 2.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole?
The IUPAC name of (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole (CID 89367458) is (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole.
What is the SMILES notation for (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole?
The canonical SMILES for (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole is CC1=N[C@@H]2CC=CC=C2S1.
What is the InChIKey of (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole?
The InChIKey is XUXQTAHHOYGSAM-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H9NS/c1-6-9-7-4-2-3-5-8(7)10-6/h2-3,5,7H,4H2,1H3/t7-/m1/s1.
What are the key properties of (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole?
(3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole has a molecular weight of 151.23 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3aR)-2-methyl-3a,4-dihydro-1,3-benzothiazole is sourced from PubChem (CID 89367458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).