C5H7F6NO2S — CID 89367524
1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide (PubChem CID 89367524) has the molecular formula C5H7F6NO2S and a molecular weight of 259.17 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 89367524 |
| Molecular Formula | C5H7F6NO2S |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide |
| SMILES | CNS(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C5H7F6NO2S/c1-3(6,7)4(8,9)5(10,11)15(13,14)12-2/h12H,1-2H3 |
| InChIKey | VLBANXWRWQRJTB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|