About (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine
(2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine (PubChem CID 89367584) has the molecular formula C8H12ClNS
and a molecular weight of 189.71 g/mol. Its IUPAC name is (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine |
| PubChem CID | 89367584 |
| Molecular Formula | C8H12ClNS |
| Molecular Weight | 189.71 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine |
| SMILES | C/C=C(Cl)\C=C1/CN[C@@H](C)S1 |
| InChI | InChI=1S/C8H12ClNS/c1-3-7(9)4-8-5-10-6(2)11-8/h3-4,6,10H,5H2,1-2H3/b7-3+,8-4+/t6-/m1/s1 |
| InChIKey | OEHWKFAKYQOUPH-AMSYLRIOSA-N |
| XLogP | 2.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine?
The IUPAC name of (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine (CID 89367584) is (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine.
What is the SMILES notation for (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine?
The canonical SMILES for (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine is C/C=C(Cl)\C=C1/CN[C@@H](C)S1.
What is the InChIKey of (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine?
The InChIKey is OEHWKFAKYQOUPH-AMSYLRIOSA-N. The full InChI is InChI=1S/C8H12ClNS/c1-3-7(9)4-8-5-10-6(2)11-8/h3-4,6,10H,5H2,1-2H3/b7-3+,8-4+/t6-/m1/s1.
What are the key properties of (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine?
(2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine has a molecular weight of 189.71 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5E)-5-[(E)-2-chlorobut-2-enylidene]-2-methyl-1,3-thiazolidine is sourced from PubChem (CID 89367584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).