About 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline
2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline (PubChem CID 89367614) has the molecular formula C15H17N3
and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline.
Molecular Properties
| Compound Name | 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline |
| PubChem CID | 89367614 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline |
| SMILES | [H]/N=N/c1cc(-c2c(C)cccc2C)cc(C)c1N |
| InChI | InChI=1S/C15H17N3/c1-9-5-4-6-10(2)14(9)12-7-11(3)15(16)13(8-12)18-17/h4-8,17H,16H2,1-3H3/b18-17+ |
| InChIKey | QOVBYHBEPIPINI-ISLYRVAYSA-N |
| XLogP | 4.52 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline?
The IUPAC name of 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline (CID 89367614) is 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline.
What is the SMILES notation for 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline?
The canonical SMILES for 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline is [H]/N=N/c1cc(-c2c(C)cccc2C)cc(C)c1N.
What is the InChIKey of 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline?
The InChIKey is QOVBYHBEPIPINI-ISLYRVAYSA-N. The full InChI is InChI=1S/C15H17N3/c1-9-5-4-6-10(2)14(9)12-7-11(3)15(16)13(8-12)18-17/h4-8,17H,16H2,1-3H3/b18-17+.
What are the key properties of 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline?
2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline has a molecular weight of 239.32 g/mol, XLogP of 4.52, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazenyl-4-(2,6-dimethylphenyl)-6-methylaniline is sourced from PubChem (CID 89367614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).