C19H20N2O3 — CID 89367782
trans-(1S,2S)-N-[(1S)-1-[6-(2-oxoethoxy)-3-pyridinyl]ethyl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 89367782) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is trans-(1S,2S)-N-[(1S)-1-[6-(2-oxoethoxy)-3-pyridinyl]ethyl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[(1S)-1-[6-(2-oxoethoxy)-3-pyridinyl]ethyl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 89367782 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | trans-(1S,2S)-N-[(1S)-1-[6-(2-oxoethoxy)-3-pyridinyl]ethyl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1C[C@@H]1c1ccccc1)c1ccc(OCC=O)nc1 |
| InChI | InChI=1S/C19H20N2O3/c1-13(15-7-8-18(20-12-15)24-10-9-22)21-19(23)17-11-16(17)14-5-3-2-4-6-14/h2-9,12-13,16-17H,10-11H2,1H3,(H,21,23)/t13-,16+,17-/m0/s1 |
| InChIKey | SZMWOXALBYTDKS-XKQJLSEDSA-N |
| XLogP | 2.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|