About [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate
[2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate (PubChem CID 89367826) has the molecular formula C25H36O8
and a molecular weight of 464.56 g/mol. Its IUPAC name is [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate.
Molecular Properties
| Compound Name | [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate |
| PubChem CID | 89367826 |
| Molecular Formula | C25H36O8 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate |
| SMILES | C=CC(=O)CCC(CC)(COCC(CC)(COC(=O)C=C)COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C25H36O8/c1-7-20(26)13-14-24(11-5,17-31-21(27)8-2)15-30-16-25(12-6,18-32-22(28)9-3)19-33-23(29)10-4/h7-10H,1-4,11-19H2,5-6H3 |
| InChIKey | AYXCJOYNMVZRNF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate?
The IUPAC name of [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate (CID 89367826) is [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate.
What is the SMILES notation for [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate?
The canonical SMILES for [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate is C=CC(=O)CCC(CC)(COCC(CC)(COC(=O)C=C)COC(=O)C=C)COC(=O)C=C.
What is the InChIKey of [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate?
The InChIKey is AYXCJOYNMVZRNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36O8/c1-7-20(26)13-14-24(11-5,17-31-21(27)8-2)15-30-16-25(12-6,18-32-22(28)9-3)19-33-23(29)10-4/h7-10H,1-4,11-19H2,5-6H3.
What are the key properties of [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate?
[2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate has a molecular weight of 464.56 g/mol, XLogP of 3.52, 19 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2,2-bis(prop-2-enoyloxymethyl)butoxymethyl]-2-ethyl-5-oxohept-6-enyl] prop-2-enoate is sourced from PubChem (CID 89367826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).