C15H10ClF3N4O3 — CID 89368177
8-chloro-5-[3-(trifluoromethoxy)phenyl]-10,14-dioxa-3,4,6,7-tetrazatricyclo[7.5.0.02,6]tetradeca-1(9),2,4,7-tetraene (PubChem CID 89368177) has the molecular formula C15H10ClF3N4O3 and a molecular weight of 386.72 g/mol. Its IUPAC name is 8-chloro-5-[3-(trifluoromethoxy)phenyl]-10,14-dioxa-3,4,6,7-tetrazatricyclo[7.5.0.02,6]tetradeca-1(9),2,4,7-tetraene.
| Compound Name | 8-chloro-5-[3-(trifluoromethoxy)phenyl]-10,14-dioxa-3,4,6,7-tetrazatricyclo[7.5.0.02,6]tetradeca-1(9),2,4,7-tetraene |
|---|---|
| PubChem CID | 89368177 |
| Molecular Formula | C15H10ClF3N4O3 |
| Molecular Weight | 386.72 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 8-chloro-5-[3-(trifluoromethoxy)phenyl]-10,14-dioxa-3,4,6,7-tetrazatricyclo[7.5.0.02,6]tetradeca-1(9),2,4,7-tetraene |
| SMILES | FC(F)(F)Oc1cccc(-c2nnc3c4c(c(Cl)nn23)OCCCO4)c1 |
| InChI | InChI=1S/C15H10ClF3N4O3/c16-12-10-11(25-6-2-5-24-10)14-21-20-13(23(14)22-12)8-3-1-4-9(7-8)26-15(17,18)19/h1,3-4,7H,2,5-6H2 |
| InChIKey | BHTQRBLTIHOOTK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 70.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |