About (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone
(3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone (PubChem CID 89369072) has the molecular formula C20H23N3O3
and a molecular weight of 353.42 g/mol. Its IUPAC name is (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone.
Molecular Properties
| Compound Name | (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone |
| PubChem CID | 89369072 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone |
| SMILES | COc1ccc(C2=NN(C(=O)c3cccc(N)c3)C(C)(C)C2)cc1OC |
| InChI | InChI=1S/C20H23N3O3/c1-20(2)12-16(13-8-9-17(25-3)18(11-13)26-4)22-23(20)19(24)14-6-5-7-15(21)10-14/h5-11H,12,21H2,1-4H3 |
| InChIKey | PCYOSQMKMQWVSH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone?
The IUPAC name of (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone (CID 89369072) is (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone.
What is the SMILES notation for (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone?
The canonical SMILES for (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone is COc1ccc(C2=NN(C(=O)c3cccc(N)c3)C(C)(C)C2)cc1OC.
What is the InChIKey of (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone?
The InChIKey is PCYOSQMKMQWVSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O3/c1-20(2)12-16(13-8-9-17(25-3)18(11-13)26-4)22-23(20)19(24)14-6-5-7-15(21)10-14/h5-11H,12,21H2,1-4H3.
What are the key properties of (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone?
(3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone has a molecular weight of 353.42 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone is sourced from PubChem (CID 89369072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).