About O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate
O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate (PubChem CID 89369252) has the molecular formula C15H10ClNO4S
and a molecular weight of 335.77 g/mol. Its IUPAC name is O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate.
Molecular Properties
| Compound Name | O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate |
| PubChem CID | 89369252 |
| Molecular Formula | C15H10ClNO4S |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate |
| SMILES | COc1ccc(OC(=S)n2c(=O)oc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C15H10ClNO4S/c1-19-10-3-5-11(6-4-10)20-15(22)17-12-8-9(16)2-7-13(12)21-14(17)18/h2-8H,1H3 |
| InChIKey | RTUFSRBFCDQPHT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate?
The IUPAC name of O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate (CID 89369252) is O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate.
What is the SMILES notation for O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate?
The canonical SMILES for O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate is COc1ccc(OC(=S)n2c(=O)oc3ccc(Cl)cc32)cc1.
What is the InChIKey of O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate?
The InChIKey is RTUFSRBFCDQPHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClNO4S/c1-19-10-3-5-11(6-4-10)20-15(22)17-12-8-9(16)2-7-13(12)21-14(17)18/h2-8H,1H3.
What are the key properties of O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate?
O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate has a molecular weight of 335.77 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for O-(4-methoxyphenyl) 5-chloro-2-oxo-1,3-benzoxazole-3-carbothioate is sourced from PubChem (CID 89369252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).