About cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane
cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane (PubChem CID 89369308) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane.
Molecular Properties
| Compound Name | cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane |
| PubChem CID | 89369308 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane |
| SMILES | C=COC[C@H]1CCC[C@@H](COC=C)C1 |
| InChI | InChI=1S/C12H20O2/c1-3-13-9-11-6-5-7-12(8-11)10-14-4-2/h3-4,11-12H,1-2,5-10H2/t11-,12+ |
| InChIKey | LOOYJZBLGZKXQB-TXEJJXNPSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane?
The IUPAC name of cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane (CID 89369308) is cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane.
What is the SMILES notation for cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane?
The canonical SMILES for cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane is C=COC[C@H]1CCC[C@@H](COC=C)C1.
What is the InChIKey of cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane?
The InChIKey is LOOYJZBLGZKXQB-TXEJJXNPSA-N. The full InChI is InChI=1S/C12H20O2/c1-3-13-9-11-6-5-7-12(8-11)10-14-4-2/h3-4,11-12H,1-2,5-10H2/t11-,12+.
What are the key properties of cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane?
cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane has a molecular weight of 196.29 g/mol, XLogP of 3.11, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-1,3-bis(ethenoxymethyl)cyclohexane is sourced from PubChem (CID 89369308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).