About 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide
2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide (PubChem CID 89369313) has the molecular formula C16H30N4O3
and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide.
Molecular Properties
| Compound Name | 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide |
| PubChem CID | 89369313 |
| Molecular Formula | C16H30N4O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide |
| SMILES | C=C(NCC(=O)NCC(N)=O)C(N)CCC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C16H30N4O3/c1-11(19-10-15(23)20-9-14(18)22)13(17)6-5-12(21)7-8-16(2,3)4/h13,19H,1,5-10,17H2,2-4H3,(H2,18,22)(H,20,23) |
| InChIKey | FNMGOUZRZCKVDJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide?
The IUPAC name of 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide (CID 89369313) is 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide.
What is the SMILES notation for 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide?
The canonical SMILES for 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide is C=C(NCC(=O)NCC(N)=O)C(N)CCC(=O)CCC(C)(C)C.
What is the InChIKey of 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide?
The InChIKey is FNMGOUZRZCKVDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N4O3/c1-11(19-10-15(23)20-9-14(18)22)13(17)6-5-12(21)7-8-16(2,3)4/h13,19H,1,5-10,17H2,2-4H3,(H2,18,22)(H,20,23).
What are the key properties of 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide?
2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide has a molecular weight of 326.44 g/mol, XLogP of 0.19, 11 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[(3-amino-9,9-dimethyl-6-oxodec-1-en-2-yl)amino]acetyl]amino]acetamide is sourced from PubChem (CID 89369313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).