C22H22N6O — CID 89369421
1-(4-aminophenyl)-N-(2,4-dimethyl-3-pyridinyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 89369421) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N-(2,4-dimethyl-3-pyridinyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | 1-(4-aminophenyl)-N-(2,4-dimethyl-3-pyridinyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 89369421 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 1-(4-aminophenyl)-N-(2,4-dimethyl-3-pyridinyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2c(C)ccnc2C)c2c(C)nn(-c3ccc(N)cc3)c2n1 |
| InChI | InChI=1S/C22H22N6O/c1-12-9-10-24-15(4)20(12)26-22(29)18-11-13(2)25-21-19(18)14(3)27-28(21)17-7-5-16(23)6-8-17/h5-11H,23H2,1-4H3,(H,26,29) |
| InChIKey | UCGYQWWWESHKLV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|