C9H12F4O3S — CID 89369477
1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfinic acid (PubChem CID 89369477) has the molecular formula C9H12F4O3S and a molecular weight of 276.25 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfinic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfinic acid |
|---|---|
| PubChem CID | 89369477 |
| Molecular Formula | C9H12F4O3S |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfinic acid |
| SMILES | O=S(O)C(F)(F)C(F)(F)C1CC2CC1CC2O |
| InChI | InChI=1S/C9H12F4O3S/c10-8(11,9(12,13)17(15)16)6-2-5-1-4(6)3-7(5)14/h4-7,14H,1-3H2,(H,15,16) |
| InChIKey | YIEWZFQDDIEKLJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|