About 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one
4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one (PubChem CID 89369587) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one.
Molecular Properties
| Compound Name | 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one |
| PubChem CID | 89369587 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one |
| SMILES | C/C=C\C=C(/C)N(C)CCC(C)=O |
| InChI | InChI=1S/C11H19NO/c1-5-6-7-10(2)12(4)9-8-11(3)13/h5-7H,8-9H2,1-4H3/b6-5-,10-7+ |
| InChIKey | GGSFXVLNRACHBM-ZZWPSLBBSA-N |
| XLogP | 2.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one?
The IUPAC name of 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one (CID 89369587) is 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one.
What is the SMILES notation for 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one?
The canonical SMILES for 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one is C/C=C\C=C(/C)N(C)CCC(C)=O.
What is the InChIKey of 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one?
The InChIKey is GGSFXVLNRACHBM-ZZWPSLBBSA-N. The full InChI is InChI=1S/C11H19NO/c1-5-6-7-10(2)12(4)9-8-11(3)13/h5-7H,8-9H2,1-4H3/b6-5-,10-7+.
What are the key properties of 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one?
4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one has a molecular weight of 181.28 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]butan-2-one is sourced from PubChem (CID 89369587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).