C24H27NO2 — CID 89369729
9H-fluoren-9-ylmethyl (3S)-3-methyl-3-prop-2-enylpiperidine-1-carboxylate (PubChem CID 89369729) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3S)-3-methyl-3-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (3S)-3-methyl-3-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 89369729 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3S)-3-methyl-3-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CC[C@]1(C)CCCN(C(=O)OCC2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C24H27NO2/c1-3-13-24(2)14-8-15-25(17-24)23(26)27-16-22-20-11-6-4-9-18(20)19-10-5-7-12-21(19)22/h3-7,9-12,22H,1,8,13-17H2,2H3/t24-/m1/s1 |
| InChIKey | UFWQMEVEUFYDAM-XMMPIXPASA-N |
| XLogP | 5.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|