C13H21IO2 — CID 89370413
[(2S,4E,6E)-7-iodo-3,5-dimethylhepta-4,6-dien-2-yl] 2-methylpropanoate (PubChem CID 89370413) has the molecular formula C13H21IO2 and a molecular weight of 336.21 g/mol. Its IUPAC name is [(2S,4E,6E)-7-iodo-3,5-dimethylhepta-4,6-dien-2-yl] 2-methylpropanoate.
| Compound Name | [(2S,4E,6E)-7-iodo-3,5-dimethylhepta-4,6-dien-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 89370413 |
| Molecular Formula | C13H21IO2 |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [(2S,4E,6E)-7-iodo-3,5-dimethylhepta-4,6-dien-2-yl] 2-methylpropanoate |
| SMILES | CC(/C=C/I)=C\C(C)[C@H](C)OC(=O)C(C)C |
| InChI | InChI=1S/C13H21IO2/c1-9(2)13(15)16-12(5)11(4)8-10(3)6-7-14/h6-9,11-12H,1-5H3/b7-6+,10-8+/t11?,12-/m0/s1 |
| InChIKey | QVUWUBYWNZKKOD-AWAUNZMZSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|