About 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine
5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine (PubChem CID 89370463) has the molecular formula C9H10FN3O
and a molecular weight of 195.20 g/mol. Its IUPAC name is 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine.
Molecular Properties
| Compound Name | 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine |
| PubChem CID | 89370463 |
| Molecular Formula | C9H10FN3O |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine |
| SMILES | CN(C)c1nc2cc(F)c(N)cc2o1 |
| InChI | InChI=1S/C9H10FN3O/c1-13(2)9-12-7-3-5(10)6(11)4-8(7)14-9/h3-4H,11H2,1-2H3 |
| InChIKey | HYEAYKVFXQUNSM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine?
The IUPAC name of 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine (CID 89370463) is 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine.
What is the SMILES notation for 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine?
The canonical SMILES for 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine is CN(C)c1nc2cc(F)c(N)cc2o1.
What is the InChIKey of 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine?
The InChIKey is HYEAYKVFXQUNSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3O/c1-13(2)9-12-7-3-5(10)6(11)4-8(7)14-9/h3-4H,11H2,1-2H3.
What are the key properties of 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine?
5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine has a molecular weight of 195.20 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-N,2-N-dimethyl-1,3-benzoxazole-2,6-diamine is sourced from PubChem (CID 89370463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).