C7H15N3 — CID 89370528
(2Z,4E)-4-methylhexa-2,4-diene-2,3,5-triamine (PubChem CID 89370528) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is (2Z,4E)-4-methylhexa-2,4-diene-2,3,5-triamine.
| Compound Name | (2Z,4E)-4-methylhexa-2,4-diene-2,3,5-triamine |
|---|---|
| PubChem CID | 89370528 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (2Z,4E)-4-methylhexa-2,4-diene-2,3,5-triamine |
| SMILES | C/C(N)=C(N)\C(C)=C(/C)N |
| InChI | InChI=1S/C7H15N3/c1-4(5(2)8)7(10)6(3)9/h8-10H2,1-3H3/b5-4+,7-6- |
| InChIKey | BNYIVWCGFHKMJV-DEQVHDEQSA-N |
| XLogP | 0.39 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|