About 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one
5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one (PubChem CID 89370533) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one.
Molecular Properties
| Compound Name | 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one |
| PubChem CID | 89370533 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one |
| SMILES | CCC(C)(O)C(=O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H30O2/c1-9-15(8,17)12(16)11(14(5,6)7)10-13(2,3)4/h11,17H,9-10H2,1-8H3 |
| InChIKey | OHLSELMMYXZHFN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one?
The IUPAC name of 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one (CID 89370533) is 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one.
What is the SMILES notation for 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one?
The canonical SMILES for 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one is CCC(C)(O)C(=O)C(CC(C)(C)C)C(C)(C)C.
What is the InChIKey of 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one?
The InChIKey is OHLSELMMYXZHFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2/c1-9-15(8,17)12(16)11(14(5,6)7)10-13(2,3)4/h11,17H,9-10H2,1-8H3.
What are the key properties of 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one?
5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one has a molecular weight of 242.40 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3-hydroxy-3,7,7-trimethyloctan-4-one is sourced from PubChem (CID 89370533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).