C8H3Cl4F5O — CID 89370571
2,3,4,5,6-pentafluorophenol;1,1,2,2-tetrachloro-1,2-dideuterioethane (PubChem CID 89370571) has the molecular formula C8H3Cl4F5O and a molecular weight of 353.93 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorophenol;1,1,2,2-tetrachloro-1,2-dideuterioethane.
| Compound Name | 2,3,4,5,6-pentafluorophenol;1,1,2,2-tetrachloro-1,2-dideuterioethane |
|---|---|
| PubChem CID | 89370571 |
| Molecular Formula | C8H3Cl4F5O |
| Molecular Weight | 353.93 g/mol |
| Exact Mass | 351.90 |
| IUPAC Name | 2,3,4,5,6-pentafluorophenol;1,1,2,2-tetrachloro-1,2-dideuterioethane |
| SMILES | Oc1c(F)c(F)c(F)c(F)c1F.[2H]C(Cl)(Cl)C([2H])(Cl)Cl |
| InChI | InChI=1S/C6HF5O.C2H2Cl4/c7-1-2(8)4(10)6(12)5(11)3(1)9;3-1(4)2(5)6/h12H;1-2H/i;1D,2D |
| InChIKey | YWBJBYYEKQATAK-LHVCLSMISA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.93 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|