About 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride
2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride (PubChem CID 89370765) has the molecular formula C25H25Cl2N3O
and a molecular weight of 454.40 g/mol. Its IUPAC name is 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride |
| PubChem CID | 89370765 |
| Molecular Formula | C25H25Cl2N3O |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride |
| SMILES | Cc1ccccc1N(C)C(C(=O)Nc1ccc2cnccc2c1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C25H23N3O.2ClH/c1-18-8-6-7-11-23(18)28(2)24(19-9-4-3-5-10-19)25(29)27-22-13-12-21-17-26-15-14-20(21)16-22;;/h3-17,24H,1-2H3,(H,27,29);2*1H |
| InChIKey | SFJSRPHLJDOULI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride?
The IUPAC name of 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride (CID 89370765) is 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride.
What is the SMILES notation for 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride?
The canonical SMILES for 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride is Cc1ccccc1N(C)C(C(=O)Nc1ccc2cnccc2c1)c1ccccc1.Cl.Cl.
What is the InChIKey of 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride?
The InChIKey is SFJSRPHLJDOULI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O.2ClH/c1-18-8-6-7-11-23(18)28(2)24(19-9-4-3-5-10-19)25(29)27-22-13-12-21-17-26-15-14-20(21)16-22;;/h3-17,24H,1-2H3,(H,27,29);2*1H.
What are the key properties of 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride?
2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride has a molecular weight of 454.40 g/mol, XLogP of 6.20, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N,2-dimethylanilino)-N-isoquinolin-6-yl-2-phenylacetamide;dihydrochloride is sourced from PubChem (CID 89370765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).