C24H21F4N7O — CID 89370781
[4-[3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]azetidin-1-yl]piperidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone (PubChem CID 89370781) has the molecular formula C24H21F4N7O and a molecular weight of 499.47 g/mol. Its IUPAC name is [4-[3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]azetidin-1-yl]piperidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone.
| Compound Name | [4-[3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]azetidin-1-yl]piperidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 89370781 |
| Molecular Formula | C24H21F4N7O |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | [4-[3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]azetidin-1-yl]piperidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1F)N1CCC(N2CC(n3cc(-c4ncnc5[nH]ccc45)cn3)C2)CC1 |
| InChI | InChI=1S/C24H21F4N7O/c25-18-7-17(19(26)21(28)20(18)27)24(36)33-5-2-14(3-6-33)34-10-15(11-34)35-9-13(8-32-35)22-16-1-4-29-23(16)31-12-30-22/h1,4,7-9,12,14-15H,2-3,5-6,10-11H2,(H,29,30,31) |
| InChIKey | YRAOLVRCZIVKFL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|