C25H30N2O6S — CID 89370808
5-cyclopropyl-4-[2-(4-methylphenyl)sulfonyloxyethyl]-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylic acid (PubChem CID 89370808) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is 5-cyclopropyl-4-[2-(4-methylphenyl)sulfonyloxyethyl]-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylic acid.
| Compound Name | 5-cyclopropyl-4-[2-(4-methylphenyl)sulfonyloxyethyl]-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylic acid |
|---|---|
| PubChem CID | 89370808 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 5-cyclopropyl-4-[2-(4-methylphenyl)sulfonyloxyethyl]-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)OCCN2CCOc3cc4c(c(C5CC5)c32)CCN(C(=O)O)CC4)cc1 |
| InChI | InChI=1S/C25H30N2O6S/c1-17-2-6-20(7-3-17)34(30,31)33-15-13-26-12-14-32-22-16-19-8-10-27(25(28)29)11-9-21(19)23(24(22)26)18-4-5-18/h2-3,6-7,16,18H,4-5,8-15H2,1H3,(H,28,29) |
| InChIKey | SQRVNRLEDLTGIR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|