C19H22F2N6 — CID 89370811
(2Z,4Z)-5-[3-(4,4-difluoropiperidin-1-yl)-1-pyridin-3-ylpyrazol-5-yl]-5-(methylideneamino)penta-2,4-dien-2-amine (PubChem CID 89370811) has the molecular formula C19H22F2N6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (2Z,4Z)-5-[3-(4,4-difluoropiperidin-1-yl)-1-pyridin-3-ylpyrazol-5-yl]-5-(methylideneamino)penta-2,4-dien-2-amine.
| Compound Name | (2Z,4Z)-5-[3-(4,4-difluoropiperidin-1-yl)-1-pyridin-3-ylpyrazol-5-yl]-5-(methylideneamino)penta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 89370811 |
| Molecular Formula | C19H22F2N6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (2Z,4Z)-5-[3-(4,4-difluoropiperidin-1-yl)-1-pyridin-3-ylpyrazol-5-yl]-5-(methylideneamino)penta-2,4-dien-2-amine |
| SMILES | C=N/C(=C\C=C(\C)N)c1cc(N2CCC(F)(F)CC2)nn1-c1cccnc1 |
| InChI | InChI=1S/C19H22F2N6/c1-14(22)5-6-16(23-2)17-12-18(26-10-7-19(20,21)8-11-26)25-27(17)15-4-3-9-24-13-15/h3-6,9,12-13H,2,7-8,10-11,22H2,1H3/b14-5-,16-6- |
| InChIKey | GBZVEIPERNTZMO-ONYQNAODSA-N |
| XLogP | 3.41 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|