About S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate
S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate (PubChem CID 89371272) has the molecular formula C14H26O3S
and a molecular weight of 274.43 g/mol. Its IUPAC name is S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate.
Molecular Properties
| Compound Name | S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate |
| PubChem CID | 89371272 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate |
| SMILES | COCCSC(=O)C(C)(C)CCOC1CC1(C)C |
| InChI | InChI=1S/C14H26O3S/c1-13(2,12(15)18-9-8-16-5)6-7-17-11-10-14(11,3)4/h11H,6-10H2,1-5H3 |
| InChIKey | DNGBAOZUAIWCKE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate?
The IUPAC name of S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate (CID 89371272) is S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate.
What is the SMILES notation for S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate?
The canonical SMILES for S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate is COCCSC(=O)C(C)(C)CCOC1CC1(C)C.
What is the InChIKey of S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate?
The InChIKey is DNGBAOZUAIWCKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3S/c1-13(2,12(15)18-9-8-16-5)6-7-17-11-10-14(11,3)4/h11H,6-10H2,1-5H3.
What are the key properties of S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate?
S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate has a molecular weight of 274.43 g/mol, XLogP of 3.12, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-methoxyethyl) 4-(2,2-dimethylcyclopropyl)oxy-2,2-dimethylbutanethioate is sourced from PubChem (CID 89371272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).