About N-ethylidenebutanamide
N-ethylidenebutanamide (PubChem CID 89371556) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is N-ethylidenebutanamide.
Molecular Properties
| Compound Name | N-ethylidenebutanamide |
| PubChem CID | 89371556 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | N-ethylidenebutanamide |
| SMILES | C/C=N/C(=O)CCC |
| InChI | InChI=1S/C6H11NO/c1-3-5-6(8)7-4-2/h4H,3,5H2,1-2H3/b7-4+ |
| InChIKey | SMSKRTVEUYDOCV-QPJJXVBHSA-N |
| XLogP | 1.40 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethylidenebutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylidenebutanamide?
The IUPAC name of N-ethylidenebutanamide (CID 89371556) is N-ethylidenebutanamide.
What is the SMILES notation for N-ethylidenebutanamide?
The canonical SMILES for N-ethylidenebutanamide is C/C=N/C(=O)CCC.
What is the InChIKey of N-ethylidenebutanamide?
The InChIKey is SMSKRTVEUYDOCV-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H11NO/c1-3-5-6(8)7-4-2/h4H,3,5H2,1-2H3/b7-4+.
What are the key properties of N-ethylidenebutanamide?
N-ethylidenebutanamide has a molecular weight of 113.16 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylidenebutanamide is sourced from PubChem (CID 89371556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).