C14H20N4O3 — CID 89371656
(3Z)-1-acetyl-3-[(2Z)-2,3-diamino-4,4-dimethylhexa-2,5-dienylidene]piperazine-2,5-dione (PubChem CID 89371656) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is (3Z)-1-acetyl-3-[(2Z)-2,3-diamino-4,4-dimethylhexa-2,5-dienylidene]piperazine-2,5-dione.
| Compound Name | (3Z)-1-acetyl-3-[(2Z)-2,3-diamino-4,4-dimethylhexa-2,5-dienylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 89371656 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (3Z)-1-acetyl-3-[(2Z)-2,3-diamino-4,4-dimethylhexa-2,5-dienylidene]piperazine-2,5-dione |
| SMILES | C=CC(C)(C)/C(N)=C(N)\C=C1/NC(=O)CN(C(C)=O)C1=O |
| InChI | InChI=1S/C14H20N4O3/c1-5-14(3,4)12(16)9(15)6-10-13(21)18(8(2)19)7-11(20)17-10/h5-6H,1,7,15-16H2,2-4H3,(H,17,20)/b10-6-,12-9- |
| InChIKey | GXPFYAHXIDGNHY-LQBUGXQISA-N |
| XLogP | -0.28 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|