C19H21N5O2 — CID 89371670
(3Z,6Z)-3-[(4-aminophenyl)methylidene]-6-[(5-tert-butyl-1H-imidazol-4-yl)methylidene]piperazine-2,5-dione (PubChem CID 89371670) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is (3Z,6Z)-3-[(4-aminophenyl)methylidene]-6-[(5-tert-butyl-1H-imidazol-4-yl)methylidene]piperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3-[(4-aminophenyl)methylidene]-6-[(5-tert-butyl-1H-imidazol-4-yl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 89371670 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (3Z,6Z)-3-[(4-aminophenyl)methylidene]-6-[(5-tert-butyl-1H-imidazol-4-yl)methylidene]piperazine-2,5-dione |
| SMILES | CC(C)(C)c1[nH]cnc1/C=c1\[nH]c(=O)/c(=C/c2ccc(N)cc2)[nH]c1=O |
| InChI | InChI=1S/C19H21N5O2/c1-19(2,3)16-13(21-10-22-16)9-15-18(26)23-14(17(25)24-15)8-11-4-6-12(20)7-5-11/h4-10H,20H2,1-3H3,(H,21,22)(H,23,26)(H,24,25)/b14-8-,15-9- |
| InChIKey | FFLFKPJFIZYHJH-SFGFDRCGSA-N |
| XLogP | 0.32 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|