C23H41ClN4O5 — CID 89371974
(2R,3R,5R,6S,7R)-2-[(5-amino-6-chloropyrimidin-4-yl)amino]-5,6-dibutoxy-7-(butoxymethyl)oxepan-3-ol (PubChem CID 89371974) has the molecular formula C23H41ClN4O5 and a molecular weight of 489.06 g/mol. Its IUPAC name is (2R,3R,5R,6S,7R)-2-[(5-amino-6-chloropyrimidin-4-yl)amino]-5,6-dibutoxy-7-(butoxymethyl)oxepan-3-ol.
| Compound Name | (2R,3R,5R,6S,7R)-2-[(5-amino-6-chloropyrimidin-4-yl)amino]-5,6-dibutoxy-7-(butoxymethyl)oxepan-3-ol |
|---|---|
| PubChem CID | 89371974 |
| Molecular Formula | C23H41ClN4O5 |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | (2R,3R,5R,6S,7R)-2-[(5-amino-6-chloropyrimidin-4-yl)amino]-5,6-dibutoxy-7-(butoxymethyl)oxepan-3-ol |
| SMILES | CCCCOC[C@H]1O[C@@H](Nc2ncnc(Cl)c2N)[C@H](O)C[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C23H41ClN4O5/c1-4-7-10-30-14-18-20(32-12-9-6-3)17(31-11-8-5-2)13-16(29)23(33-18)28-22-19(25)21(24)26-15-27-22/h15-18,20,23,29H,4-14,25H2,1-3H3,(H,26,27,28)/t16-,17-,18-,20+,23-/m1/s1 |
| InChIKey | ZWHXZTMMGUUCDN-FEINNRIKSA-N |
| XLogP | 3.79 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|