C16H32O6Si — CID 89372031
2-[5-[(1S)-1,3-dihydroxy-2-triethylsilyloxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde (PubChem CID 89372031) has the molecular formula C16H32O6Si and a molecular weight of 348.51 g/mol. Its IUPAC name is 2-[5-[(1S)-1,3-dihydroxy-2-triethylsilyloxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde.
| Compound Name | 2-[5-[(1S)-1,3-dihydroxy-2-triethylsilyloxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 89372031 |
| Molecular Formula | C16H32O6Si |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[5-[(1S)-1,3-dihydroxy-2-triethylsilyloxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
| SMILES | CC[Si](CC)(CC)OC(CO)[C@@H](O)C1OC(C)(C)OC1CC=O |
| InChI | InChI=1S/C16H32O6Si/c1-6-23(7-2,8-3)22-13(11-18)14(19)15-12(9-10-17)20-16(4,5)21-15/h10,12-15,18-19H,6-9,11H2,1-5H3/t12?,13?,14-,15?/m1/s1 |
| InChIKey | WOVMCOOGRFWTHG-MIGSVPMKSA-N |
| XLogP | 1.84 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|