About 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde
5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 89372052) has the molecular formula C22H42O6
and a molecular weight of 402.57 g/mol. Its IUPAC name is 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde |
| PubChem CID | 89372052 |
| Molecular Formula | C22H42O6 |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCCCOC(CC(C)OC(CC)(CC)OC)C1OC(CC)(CC)OC1C=O |
| InChI | InChI=1S/C22H42O6/c1-8-13-14-25-18(15-17(6)26-21(9-2,10-3)24-7)20-19(16-23)27-22(11-4,12-5)28-20/h16-20H,8-15H2,1-7H3 |
| InChIKey | PZMVTVRJPZNQMM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde?
The IUPAC name of 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde (CID 89372052) is 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde.
What is the SMILES notation for 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde?
The canonical SMILES for 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde is CCCCOC(CC(C)OC(CC)(CC)OC)C1OC(CC)(CC)OC1C=O.
What is the InChIKey of 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde?
The InChIKey is PZMVTVRJPZNQMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O6/c1-8-13-14-25-18(15-17(6)26-21(9-2,10-3)24-7)20-19(16-23)27-22(11-4,12-5)28-20/h16-20H,8-15H2,1-7H3.
What are the key properties of 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde?
5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde has a molecular weight of 402.57 g/mol, XLogP of 4.63, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-butoxy-3-(3-methoxypentan-3-yloxy)butyl]-2,2-diethyl-1,3-dioxolane-4-carbaldehyde is sourced from PubChem (CID 89372052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).