About cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate
cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate (PubChem CID 89372101) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate |
| PubChem CID | 89372101 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate |
| SMILES | [H]/N=C/[C@H]1CC(C(=O)OC)C[C@@H]1O |
| InChI | InChI=1S/C8H13NO3/c1-12-8(11)5-2-6(4-9)7(10)3-5/h4-7,9-10H,2-3H2,1H3/b9-4+/t5?,6-,7+/m1/s1 |
| InChIKey | UURFJZHEAKYEOA-PWBLSYECSA-N |
| XLogP | 0.20 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate?
The IUPAC name of cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate (CID 89372101) is cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate.
What is the SMILES notation for cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate?
The canonical SMILES for cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate is [H]/N=C/[C@H]1CC(C(=O)OC)C[C@@H]1O.
What is the InChIKey of cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate?
The InChIKey is UURFJZHEAKYEOA-PWBLSYECSA-N. The full InChI is InChI=1S/C8H13NO3/c1-12-8(11)5-2-6(4-9)7(10)3-5/h4-7,9-10H,2-3H2,1H3/b9-4+/t5?,6-,7+/m1/s1.
What are the key properties of cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate?
cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate has a molecular weight of 171.20 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (3S,4R)-3-hydroxy-4-methanimidoylcyclopentane-1-carboxylate is sourced from PubChem (CID 89372101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).