C20H29N5O7 — CID 89372117
(2R,3R,4S,6R)-4-[2-[1-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]triazol-4-yl]ethyl-methylamino]-6-methyloxane-2,3-diol (PubChem CID 89372117) has the molecular formula C20H29N5O7 and a molecular weight of 451.48 g/mol. Its IUPAC name is (2R,3R,4S,6R)-4-[2-[1-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]triazol-4-yl]ethyl-methylamino]-6-methyloxane-2,3-diol.
| Compound Name | (2R,3R,4S,6R)-4-[2-[1-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]triazol-4-yl]ethyl-methylamino]-6-methyloxane-2,3-diol |
|---|---|
| PubChem CID | 89372117 |
| Molecular Formula | C20H29N5O7 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (2R,3R,4S,6R)-4-[2-[1-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]triazol-4-yl]ethyl-methylamino]-6-methyloxane-2,3-diol |
| SMILES | C[C@@H]1C[C@H](N(C)CCc2cn([C@H](CO)[C@H](O)c3ccc([N+](=O)[O-])cc3)nn2)[C@@H](O)[C@H](O)O1 |
| InChI | InChI=1S/C20H29N5O7/c1-12-9-16(19(28)20(29)32-12)23(2)8-7-14-10-24(22-21-14)17(11-26)18(27)13-3-5-15(6-4-13)25(30)31/h3-6,10,12,16-20,26-29H,7-9,11H2,1-2H3/t12-,16+,17-,18-,19-,20-/m1/s1 |
| InChIKey | VXJISZCNFZFKGL-GFTMRBQNSA-N |
| XLogP | -0.22 |
| TPSA | 167.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|