C8H14O4 — CID 89372150
(4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-one (PubChem CID 89372150) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-one.
| Compound Name | (4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-one |
|---|---|
| PubChem CID | 89372150 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-one |
| SMILES | CO[C@]1(C)CC(=O)O[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C8H14O4/c1-5-7(10)8(2,11-3)4-6(9)12-5/h5,7,10H,4H2,1-3H3/t5-,7-,8+/m0/s1 |
| InChIKey | RRPXHXXCMGKJJR-APQOSEDMSA-N |
| XLogP | 0.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |