About (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine
(2Z)-3-propan-2-ylpenta-2,4-dien-1-imine (PubChem CID 89372568) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine |
| PubChem CID | 89372568 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C(\C=C)C(C)C |
| InChI | InChI=1S/C8H13N/c1-4-8(5-6-9)7(2)3/h4-7,9H,1H2,2-3H3/b8-5+,9-6+ |
| InChIKey | CAKZQKFZSKSGOB-XVYDYJIPSA-N |
| XLogP | 2.40 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine?
The IUPAC name of (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine (CID 89372568) is (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine.
What is the SMILES notation for (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine?
The canonical SMILES for (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine is [H]/N=C/C=C(\C=C)C(C)C.
What is the InChIKey of (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine?
The InChIKey is CAKZQKFZSKSGOB-XVYDYJIPSA-N. The full InChI is InChI=1S/C8H13N/c1-4-8(5-6-9)7(2)3/h4-7,9H,1H2,2-3H3/b8-5+,9-6+.
What are the key properties of (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine?
(2Z)-3-propan-2-ylpenta-2,4-dien-1-imine has a molecular weight of 123.20 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-propan-2-ylpenta-2,4-dien-1-imine is sourced from PubChem (CID 89372568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).