C13H15FN2O4S — CID 89372881
(1S,3R)-2-(4-fluorophenyl)sulfonyl-N-hydroxy-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 89372881) has the molecular formula C13H15FN2O4S and a molecular weight of 314.34 g/mol. Its IUPAC name is (1S,3R)-2-(4-fluorophenyl)sulfonyl-N-hydroxy-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | (1S,3R)-2-(4-fluorophenyl)sulfonyl-N-hydroxy-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 89372881 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (1S,3R)-2-(4-fluorophenyl)sulfonyl-N-hydroxy-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | O=C(NO)[C@H]1C2CC[C@@H](C2)N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN2O4S/c14-9-2-5-11(6-3-9)21(19,20)16-10-4-1-8(7-10)12(16)13(17)15-18/h2-3,5-6,8,10,12,18H,1,4,7H2,(H,15,17)/t8?,10-,12+/m0/s1 |
| InChIKey | YHJGLMGGYKQXHE-USQOSVOJSA-N |
| XLogP | 0.87 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|