About iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium
iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium (PubChem CID 89373185) has the molecular formula C4H4FeN7O3+
and a molecular weight of 253.97 g/mol. Its IUPAC name is iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium.
Molecular Properties
| Compound Name | iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium |
| PubChem CID | 89373185 |
| Molecular Formula | C4H4FeN7O3+ |
| Molecular Weight | 253.97 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium |
| SMILES | O=[N+](Oc1ncn[nH]1)Oc1ncn[nH]1.[Fe] |
| InChI | InChI=1S/C4H4N7O3.Fe/c12-11(13-3-5-1-7-9-3)14-4-6-2-8-10-4;/h1-2H,(H,5,7,9)(H,6,8,10);/q+1; |
| InChIKey | UJSIERNVOOCVOM-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.97 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium?
The IUPAC name of iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium (CID 89373185) is iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium.
What is the SMILES notation for iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium?
The canonical SMILES for iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium is O=[N+](Oc1ncn[nH]1)Oc1ncn[nH]1.[Fe].
What is the InChIKey of iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium?
The InChIKey is UJSIERNVOOCVOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N7O3.Fe/c12-11(13-3-5-1-7-9-3)14-4-6-2-8-10-4;/h1-2H,(H,5,7,9)(H,6,8,10);/q+1;.
What are the key properties of iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium?
iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium has a molecular weight of 253.97 g/mol, XLogP of -1.01, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for iron;oxo-bis(1H-1,2,4-triazol-5-yloxy)azanium is sourced from PubChem (CID 89373185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).