About 3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine
3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine (PubChem CID 89373568) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine.
Analyze 3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine?
The IUPAC name of 3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine (CID 89373568) is 3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine.
What is the SMILES notation for 3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine?
The canonical SMILES for 3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine is C1=NCC=NC2=C1CCC2.
What is the InChIKey of 3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine?
The InChIKey is HFQQQVVXHHWMLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-2-7-6-9-4-5-10-8(7)3-1/h5-6H,1-4H2.
What are the key properties of 3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine?
3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine has a molecular weight of 134.18 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6,7,8-tetrahydrocyclopenta[e][1,4]diazepine is sourced from PubChem (CID 89373568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).