C7H10O6 — CID 89373829
5-ethyl-5,6-dihydroxy-1,3-dioxepane-4,7-dione (PubChem CID 89373829) has the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. Its IUPAC name is 5-ethyl-5,6-dihydroxy-1,3-dioxepane-4,7-dione.
| Compound Name | 5-ethyl-5,6-dihydroxy-1,3-dioxepane-4,7-dione |
|---|---|
| PubChem CID | 89373829 |
| Molecular Formula | C7H10O6 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 5-ethyl-5,6-dihydroxy-1,3-dioxepane-4,7-dione |
| SMILES | CCC1(O)C(=O)OCOC(=O)C1O |
| InChI | InChI=1S/C7H10O6/c1-2-7(11)4(8)5(9)12-3-13-6(7)10/h4,8,11H,2-3H2,1H3 |
| InChIKey | JEIGZZIPIMQMDW-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |