About 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde
2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde (PubChem CID 89373864) has the molecular formula C20H8Br2N2O8
and a molecular weight of 564.10 g/mol. Its IUPAC name is 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde.
Molecular Properties
| Compound Name | 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde |
| PubChem CID | 89373864 |
| Molecular Formula | C20H8Br2N2O8 |
| Molecular Weight | 564.10 g/mol |
| Exact Mass | 561.86 |
| IUPAC Name | 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde |
| SMILES | O=Cc1ccccc1-c1c2cc([N+](=O)[O-])c(=O)c(Br)c-2oc2c(Br)c(O)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C20H8Br2N2O8/c21-15-17(26)12(23(28)29)5-10-14(9-4-2-1-3-8(9)7-25)11-6-13(24(30)31)18(27)16(22)20(11)32-19(10)15/h1-7,26H |
| InChIKey | KIQNLFFIGKEPJA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 153.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.10 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde?
The IUPAC name of 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde (CID 89373864) is 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde.
What is the SMILES notation for 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde?
The canonical SMILES for 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde is O=Cc1ccccc1-c1c2cc([N+](=O)[O-])c(=O)c(Br)c-2oc2c(Br)c(O)c([N+](=O)[O-])cc12.
What is the InChIKey of 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde?
The InChIKey is KIQNLFFIGKEPJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H8Br2N2O8/c21-15-17(26)12(23(28)29)5-10-14(9-4-2-1-3-8(9)7-25)11-6-13(24(30)31)18(27)16(22)20(11)32-19(10)15/h1-7,26H.
What are the key properties of 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde?
2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde has a molecular weight of 564.10 g/mol, XLogP of 5.42, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dibromo-3-hydroxy-2,7-dinitro-6-oxoxanthen-9-yl)benzaldehyde is sourced from PubChem (CID 89373864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).