C66H50N2 — CID 89374077
6-(9,9-dimethylfluoren-2-yl)-N,9-diphenyl-N-[(3E,5E)-6-(10-phenylanthracen-9-yl)hepta-1,3,5-trien-3-yl]carbazol-3-amine (PubChem CID 89374077) has the molecular formula C66H50N2 and a molecular weight of 871.14 g/mol. Its IUPAC name is 6-(9,9-dimethylfluoren-2-yl)-N,9-diphenyl-N-[(3E,5E)-6-(10-phenylanthracen-9-yl)hepta-1,3,5-trien-3-yl]carbazol-3-amine.
| Compound Name | 6-(9,9-dimethylfluoren-2-yl)-N,9-diphenyl-N-[(3E,5E)-6-(10-phenylanthracen-9-yl)hepta-1,3,5-trien-3-yl]carbazol-3-amine |
|---|---|
| PubChem CID | 89374077 |
| Molecular Formula | C66H50N2 |
| Molecular Weight | 871.14 g/mol |
| Exact Mass | 870.40 |
| IUPAC Name | 6-(9,9-dimethylfluoren-2-yl)-N,9-diphenyl-N-[(3E,5E)-6-(10-phenylanthracen-9-yl)hepta-1,3,5-trien-3-yl]carbazol-3-amine |
| SMILES | C=C/C(=C\C=C(/C)c1c2ccccc2c(-c2ccccc2)c2ccccc12)N(c1ccccc1)c1ccc2c(c1)c1cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C66H50N2/c1-5-48(36-33-44(2)64-54-28-15-17-30-56(54)65(45-21-9-6-10-22-45)57-31-18-16-29-55(57)64)67(49-23-11-7-12-24-49)51-37-40-63-59(43-51)58-41-46(35-39-62(58)68(63)50-25-13-8-14-26-50)47-34-38-53-52-27-19-20-32-60(52)66(3,4)61(53)42-47/h5-43H,1H2,2-4H3/b44-33+,48-36+ |
| InChIKey | CAEBIKFFDFMKKV-XBVZCBJGSA-N |
| XLogP | 18.04 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.14 |
| LogP ≤ 5 | 18.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|