C16H21F3O5S — CID 89374138
4-[5,5-dimethyl-6-oxo-6-(2,2,2-trifluoroethoxy)hexan-3-yl]benzenesulfonic acid (PubChem CID 89374138) has the molecular formula C16H21F3O5S and a molecular weight of 382.40 g/mol. Its IUPAC name is 4-[5,5-dimethyl-6-oxo-6-(2,2,2-trifluoroethoxy)hexan-3-yl]benzenesulfonic acid.
| Compound Name | 4-[5,5-dimethyl-6-oxo-6-(2,2,2-trifluoroethoxy)hexan-3-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89374138 |
| Molecular Formula | C16H21F3O5S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[5,5-dimethyl-6-oxo-6-(2,2,2-trifluoroethoxy)hexan-3-yl]benzenesulfonic acid |
| SMILES | CCC(CC(C)(C)C(=O)OCC(F)(F)F)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H21F3O5S/c1-4-11(12-5-7-13(8-6-12)25(21,22)23)9-15(2,3)14(20)24-10-16(17,18)19/h5-8,11H,4,9-10H2,1-3H3,(H,21,22,23) |
| InChIKey | QYDBWUDSDMZUDV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|